C25H22ClN5O7S — CID 126118153
(2E,5R)-5-(4-chlorophenyl)-N,N-diethyl-2-[(2-hydroxy-3,5-dinitrophenyl)methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 126118153) has the molecular formula C25H22ClN5O7S and a molecular weight of 572.00 g/mol. Its IUPAC name is (2E,5R)-5-(4-chlorophenyl)-N,N-diethyl-2-[(2-hydroxy-3,5-dinitrophenyl)methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
| Compound Name | (2E,5R)-5-(4-chlorophenyl)-N,N-diethyl-2-[(2-hydroxy-3,5-dinitrophenyl)methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 126118153 |
| Molecular Formula | C25H22ClN5O7S |
| Molecular Weight | 572.00 g/mol |
| Exact Mass | 571.09 |
| IUPAC Name | (2E,5R)-5-(4-chlorophenyl)-N,N-diethyl-2-[(2-hydroxy-3,5-dinitrophenyl)methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | CCN(CC)C(=O)C1=C(C)N=c2s/c(=C/c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3O)c(=O)n2[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H22ClN5O7S/c1-4-28(5-2)24(34)20-13(3)27-25-29(21(20)14-6-8-16(26)9-7-14)23(33)19(39-25)11-15-10-17(30(35)36)12-18(22(15)32)31(37)38/h6-12,21,32H,4-5H2,1-3H3/b19-11+/t21-/m1/s1 |
| InChIKey | CNJGSZYAEVHGSZ-ZNQKWNQWSA-N |
| XLogP | 3.28 |
| TPSA | 161.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.00 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|