C31H27ClN4O4S2 — CID 126096261
(2Z,5R)-5-(4-chlorophenyl)-N,N-diethyl-7-methyl-2-[(5-nitro-2-phenylsulfanylphenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 126096261) has the molecular formula C31H27ClN4O4S2 and a molecular weight of 619.17 g/mol. Its IUPAC name is (2Z,5R)-5-(4-chlorophenyl)-N,N-diethyl-7-methyl-2-[(5-nitro-2-phenylsulfanylphenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
| Compound Name | (2Z,5R)-5-(4-chlorophenyl)-N,N-diethyl-7-methyl-2-[(5-nitro-2-phenylsulfanylphenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 126096261 |
| Molecular Formula | C31H27ClN4O4S2 |
| Molecular Weight | 619.17 g/mol |
| Exact Mass | 618.12 |
| IUPAC Name | (2Z,5R)-5-(4-chlorophenyl)-N,N-diethyl-7-methyl-2-[(5-nitro-2-phenylsulfanylphenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | CCN(CC)C(=O)C1=C(C)N=c2s/c(=C\c3cc([N+](=O)[O-])ccc3Sc3ccccc3)c(=O)n2[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H27ClN4O4S2/c1-4-34(5-2)30(38)27-19(3)33-31-35(28(27)20-11-13-22(32)14-12-20)29(37)26(42-31)18-21-17-23(36(39)40)15-16-25(21)41-24-9-7-6-8-10-24/h6-18,28H,4-5H2,1-3H3/b26-18-/t28-/m1/s1 |
| InChIKey | PBPVVRDWJAZBKK-FHMSYZJOSA-N |
| XLogP | 5.82 |
| TPSA | 97.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.17 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|