C25H22ClN3O5S — CID 4566092
propan-2-yl 5-(4-chlorophenyl)-7-methyl-2-[(4-methyl-3-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 4566092) has the molecular formula C25H22ClN3O5S and a molecular weight of 511.99 g/mol. Its IUPAC name is propan-2-yl 5-(4-chlorophenyl)-7-methyl-2-[(4-methyl-3-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | propan-2-yl 5-(4-chlorophenyl)-7-methyl-2-[(4-methyl-3-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 4566092 |
| Molecular Formula | C25H22ClN3O5S |
| Molecular Weight | 511.99 g/mol |
| Exact Mass | 511.10 |
| IUPAC Name | propan-2-yl 5-(4-chlorophenyl)-7-methyl-2-[(4-methyl-3-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CC1=C(C(=O)OC(C)C)C(c2ccc(Cl)cc2)n2c(sc(=Cc3ccc(C)c([N+](=O)[O-])c3)c2=O)=N1 |
| InChI | InChI=1S/C25H22ClN3O5S/c1-13(2)34-24(31)21-15(4)27-25-28(22(21)17-7-9-18(26)10-8-17)23(30)20(35-25)12-16-6-5-14(3)19(11-16)29(32)33/h5-13,22H,1-4H3 |
| InChIKey | WSYUCFZKIOUFFM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 103.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.99 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|