C28H27ClN4O7S — CID 4539182
2-methoxyethyl 5-(4-chlorophenyl)-7-methyl-2-[(4-morpholin-4-yl-3-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 4539182) has the molecular formula C28H27ClN4O7S and a molecular weight of 599.07 g/mol. Its IUPAC name is 2-methoxyethyl 5-(4-chlorophenyl)-7-methyl-2-[(4-morpholin-4-yl-3-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | 2-methoxyethyl 5-(4-chlorophenyl)-7-methyl-2-[(4-morpholin-4-yl-3-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 4539182 |
| Molecular Formula | C28H27ClN4O7S |
| Molecular Weight | 599.07 g/mol |
| Exact Mass | 598.13 |
| IUPAC Name | 2-methoxyethyl 5-(4-chlorophenyl)-7-methyl-2-[(4-morpholin-4-yl-3-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | COCCOC(=O)C1=C(C)N=c2sc(=Cc3ccc(N4CCOCC4)c([N+](=O)[O-])c3)c(=O)n2C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H27ClN4O7S/c1-17-24(27(35)40-14-13-38-2)25(19-4-6-20(29)7-5-19)32-26(34)23(41-28(32)30-17)16-18-3-8-21(22(15-18)33(36)37)31-9-11-39-12-10-31/h3-8,15-16,25H,9-14H2,1-2H3 |
| InChIKey | BXLYWHQVDNJPDD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 125.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.07 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|