C26H24N4O6S — CID 3331288
methyl 7-methyl-2-[(2-morpholin-4-yl-5-nitrophenyl)methylidene]-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 3331288) has the molecular formula C26H24N4O6S and a molecular weight of 520.57 g/mol. Its IUPAC name is methyl 7-methyl-2-[(2-morpholin-4-yl-5-nitrophenyl)methylidene]-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | methyl 7-methyl-2-[(2-morpholin-4-yl-5-nitrophenyl)methylidene]-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 3331288 |
| Molecular Formula | C26H24N4O6S |
| Molecular Weight | 520.57 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | methyl 7-methyl-2-[(2-morpholin-4-yl-5-nitrophenyl)methylidene]-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | COC(=O)C1=C(C)N=c2sc(=Cc3cc([N+](=O)[O-])ccc3N3CCOCC3)c(=O)n2C1c1ccccc1 |
| InChI | InChI=1S/C26H24N4O6S/c1-16-22(25(32)35-2)23(17-6-4-3-5-7-17)29-24(31)21(37-26(29)27-16)15-18-14-19(30(33)34)8-9-20(18)28-10-12-36-13-11-28/h3-9,14-15,23H,10-13H2,1-2H3 |
| InChIKey | IZSILPWHXLYJBS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 116.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.57 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|