C33H31N5O4S — CID 126279362
(2E,5S)-7-methyl-2-[[2-(4-methylpiperidin-1-yl)-5-nitrophenyl]methylidene]-3-oxo-N,5-diphenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 126279362) has the molecular formula C33H31N5O4S and a molecular weight of 593.71 g/mol. Its IUPAC name is (2E,5S)-7-methyl-2-[[2-(4-methylpiperidin-1-yl)-5-nitrophenyl]methylidene]-3-oxo-N,5-diphenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
| Compound Name | (2E,5S)-7-methyl-2-[[2-(4-methylpiperidin-1-yl)-5-nitrophenyl]methylidene]-3-oxo-N,5-diphenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 126279362 |
| Molecular Formula | C33H31N5O4S |
| Molecular Weight | 593.71 g/mol |
| Exact Mass | 593.21 |
| IUPAC Name | (2E,5S)-7-methyl-2-[[2-(4-methylpiperidin-1-yl)-5-nitrophenyl]methylidene]-3-oxo-N,5-diphenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccc2)[C@H](c2ccccc2)n2c(s/c(=C/c3cc([N+](=O)[O-])ccc3N3CCC(C)CC3)c2=O)=N1 |
| InChI | InChI=1S/C33H31N5O4S/c1-21-15-17-36(18-16-21)27-14-13-26(38(41)42)19-24(27)20-28-32(40)37-30(23-9-5-3-6-10-23)29(22(2)34-33(37)43-28)31(39)35-25-11-7-4-8-12-25/h3-14,19-21,30H,15-18H2,1-2H3,(H,35,39)/b28-20+/t30-/m0/s1 |
| InChIKey | IZIOSJVTQITRBS-RMNLPTLGSA-N |
| XLogP | 5.02 |
| TPSA | 109.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.71 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|