C28H22N4O5S — CID 126091693
(2E,5R)-5-(4-methoxyphenyl)-7-methyl-2-[(3-nitrophenyl)methylidene]-3-oxo-N-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 126091693) has the molecular formula C28H22N4O5S and a molecular weight of 526.57 g/mol. Its IUPAC name is (2E,5R)-5-(4-methoxyphenyl)-7-methyl-2-[(3-nitrophenyl)methylidene]-3-oxo-N-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
| Compound Name | (2E,5R)-5-(4-methoxyphenyl)-7-methyl-2-[(3-nitrophenyl)methylidene]-3-oxo-N-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 126091693 |
| Molecular Formula | C28H22N4O5S |
| Molecular Weight | 526.57 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | (2E,5R)-5-(4-methoxyphenyl)-7-methyl-2-[(3-nitrophenyl)methylidene]-3-oxo-N-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccc([C@@H]2C(C(=O)Nc3ccccc3)=C(C)N=c3s/c(=C/c4cccc([N+](=O)[O-])c4)c(=O)n32)cc1 |
| InChI | InChI=1S/C28H22N4O5S/c1-17-24(26(33)30-20-8-4-3-5-9-20)25(19-11-13-22(37-2)14-12-19)31-27(34)23(38-28(31)29-17)16-18-7-6-10-21(15-18)32(35)36/h3-16,25H,1-2H3,(H,30,33)/b23-16+/t25-/m1/s1 |
| InChIKey | SBZWGTYNWGNSDS-OWXSRONMSA-N |
| XLogP | 3.79 |
| TPSA | 115.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.57 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|