C32H23ClN4O6S — CID 126090514
(2E,5S)-2-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylidene]-5-(4-methoxyphenyl)-7-methyl-3-oxo-N-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 126090514) has the molecular formula C32H23ClN4O6S and a molecular weight of 627.08 g/mol. Its IUPAC name is (2E,5S)-2-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylidene]-5-(4-methoxyphenyl)-7-methyl-3-oxo-N-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
| Compound Name | (2E,5S)-2-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylidene]-5-(4-methoxyphenyl)-7-methyl-3-oxo-N-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 126090514 |
| Molecular Formula | C32H23ClN4O6S |
| Molecular Weight | 627.08 g/mol |
| Exact Mass | 626.10 |
| IUPAC Name | (2E,5S)-2-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylidene]-5-(4-methoxyphenyl)-7-methyl-3-oxo-N-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccc([C@H]2C(C(=O)Nc3ccccc3)=C(C)N=c3s/c(=C/c4ccc(-c5ccc([N+](=O)[O-])cc5Cl)o4)c(=O)n32)cc1 |
| InChI | InChI=1S/C32H23ClN4O6S/c1-18-28(30(38)35-20-6-4-3-5-7-20)29(19-8-11-22(42-2)12-9-19)36-31(39)27(44-32(36)34-18)17-23-13-15-26(43-23)24-14-10-21(37(40)41)16-25(24)33/h3-17,29H,1-2H3,(H,35,38)/b27-17+/t29-/m0/s1 |
| InChIKey | ABVWCHSQPOGYRI-HRIDGTDGSA-N |
| XLogP | 5.70 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.08 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|