C28H22N4O4S — CID 35793192
(2E,5S)-7-methyl-5-(4-methylphenyl)-2-[(4-nitrophenyl)methylidene]-3-oxo-N-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 35793192) has the molecular formula C28H22N4O4S and a molecular weight of 510.58 g/mol. Its IUPAC name is (2E,5S)-7-methyl-5-(4-methylphenyl)-2-[(4-nitrophenyl)methylidene]-3-oxo-N-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
| Compound Name | (2E,5S)-7-methyl-5-(4-methylphenyl)-2-[(4-nitrophenyl)methylidene]-3-oxo-N-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 35793192 |
| Molecular Formula | C28H22N4O4S |
| Molecular Weight | 510.58 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | (2E,5S)-7-methyl-5-(4-methylphenyl)-2-[(4-nitrophenyl)methylidene]-3-oxo-N-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccc2)[C@H](c2ccc(C)cc2)n2c(s/c(=C/c3ccc([N+](=O)[O-])cc3)c2=O)=N1 |
| InChI | InChI=1S/C28H22N4O4S/c1-17-8-12-20(13-9-17)25-24(26(33)30-21-6-4-3-5-7-21)18(2)29-28-31(25)27(34)23(37-28)16-19-10-14-22(15-11-19)32(35)36/h3-16,25H,1-2H3,(H,30,33)/b23-16+/t25-/m0/s1 |
| InChIKey | WQTDZCDQFBSMFB-ZMIGGIFCSA-N |
| XLogP | 4.09 |
| TPSA | 106.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.58 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|