C30H26N4O7S — CID 126087353
(2Z,5R)-2-[(2,3-dimethoxy-5-nitrophenyl)methylidene]-5-(4-methoxyphenyl)-7-methyl-3-oxo-N-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 126087353) has the molecular formula C30H26N4O7S and a molecular weight of 586.63 g/mol. Its IUPAC name is (2Z,5R)-2-[(2,3-dimethoxy-5-nitrophenyl)methylidene]-5-(4-methoxyphenyl)-7-methyl-3-oxo-N-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
| Compound Name | (2Z,5R)-2-[(2,3-dimethoxy-5-nitrophenyl)methylidene]-5-(4-methoxyphenyl)-7-methyl-3-oxo-N-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 126087353 |
| Molecular Formula | C30H26N4O7S |
| Molecular Weight | 586.63 g/mol |
| Exact Mass | 586.15 |
| IUPAC Name | (2Z,5R)-2-[(2,3-dimethoxy-5-nitrophenyl)methylidene]-5-(4-methoxyphenyl)-7-methyl-3-oxo-N-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccc([C@@H]2C(C(=O)Nc3ccccc3)=C(C)N=c3s/c(=C\c4cc([N+](=O)[O-])cc(OC)c4OC)c(=O)n32)cc1 |
| InChI | InChI=1S/C30H26N4O7S/c1-17-25(28(35)32-20-8-6-5-7-9-20)26(18-10-12-22(39-2)13-11-18)33-29(36)24(42-30(33)31-17)15-19-14-21(34(37)38)16-23(40-3)27(19)41-4/h5-16,26H,1-4H3,(H,32,35)/b24-15-/t26-/m1/s1 |
| InChIKey | OWDVGXLQMZFXPM-LMSRTUJASA-N |
| XLogP | 3.81 |
| TPSA | 134.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.63 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|