C32H29N5O6S — CID 126082730
(2E,5S)-5-(4-methoxyphenyl)-7-methyl-2-[(2-morpholin-4-yl-5-nitrophenyl)methylidene]-3-oxo-N-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 126082730) has the molecular formula C32H29N5O6S and a molecular weight of 611.68 g/mol. Its IUPAC name is (2E,5S)-5-(4-methoxyphenyl)-7-methyl-2-[(2-morpholin-4-yl-5-nitrophenyl)methylidene]-3-oxo-N-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
| Compound Name | (2E,5S)-5-(4-methoxyphenyl)-7-methyl-2-[(2-morpholin-4-yl-5-nitrophenyl)methylidene]-3-oxo-N-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 126082730 |
| Molecular Formula | C32H29N5O6S |
| Molecular Weight | 611.68 g/mol |
| Exact Mass | 611.18 |
| IUPAC Name | (2E,5S)-5-(4-methoxyphenyl)-7-methyl-2-[(2-morpholin-4-yl-5-nitrophenyl)methylidene]-3-oxo-N-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccc([C@H]2C(C(=O)Nc3ccccc3)=C(C)N=c3s/c(=C/c4cc([N+](=O)[O-])ccc4N4CCOCC4)c(=O)n32)cc1 |
| InChI | InChI=1S/C32H29N5O6S/c1-20-28(30(38)34-23-6-4-3-5-7-23)29(21-8-11-25(42-2)12-9-21)36-31(39)27(44-32(36)33-20)19-22-18-24(37(40)41)10-13-26(22)35-14-16-43-17-15-35/h3-13,18-19,29H,14-17H2,1-2H3,(H,34,38)/b27-19+/t29-/m0/s1 |
| InChIKey | ARNHPEZYOKPJFQ-HSUOJCLFSA-N |
| XLogP | 3.63 |
| TPSA | 128.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.68 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|