C33H30ClN5O4S — CID 126280254
(2E,5R)-5-(4-chlorophenyl)-7-methyl-2-[[2-(4-methylpiperidin-1-yl)-5-nitrophenyl]methylidene]-3-oxo-N-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 126280254) has the molecular formula C33H30ClN5O4S and a molecular weight of 628.15 g/mol. Its IUPAC name is (2E,5R)-5-(4-chlorophenyl)-7-methyl-2-[[2-(4-methylpiperidin-1-yl)-5-nitrophenyl]methylidene]-3-oxo-N-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
| Compound Name | (2E,5R)-5-(4-chlorophenyl)-7-methyl-2-[[2-(4-methylpiperidin-1-yl)-5-nitrophenyl]methylidene]-3-oxo-N-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 126280254 |
| Molecular Formula | C33H30ClN5O4S |
| Molecular Weight | 628.15 g/mol |
| Exact Mass | 627.17 |
| IUPAC Name | (2E,5R)-5-(4-chlorophenyl)-7-methyl-2-[[2-(4-methylpiperidin-1-yl)-5-nitrophenyl]methylidene]-3-oxo-N-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccc2)[C@@H](c2ccc(Cl)cc2)n2c(s/c(=C/c3cc([N+](=O)[O-])ccc3N3CCC(C)CC3)c2=O)=N1 |
| InChI | InChI=1S/C33H30ClN5O4S/c1-20-14-16-37(17-15-20)27-13-12-26(39(42)43)18-23(27)19-28-32(41)38-30(22-8-10-24(34)11-9-22)29(21(2)35-33(38)44-28)31(40)36-25-6-4-3-5-7-25/h3-13,18-20,30H,14-17H2,1-2H3,(H,36,40)/b28-19+/t30-/m1/s1 |
| InChIKey | VFJZYPHHRWJMGH-RAWKODRKSA-N |
| XLogP | 5.67 |
| TPSA | 109.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.15 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|