C30H26N4O5S — CID 124533928
(2E,5S)-N-(2,4-dimethylphenyl)-5-(4-methoxyphenyl)-7-methyl-2-[(3-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 124533928) has the molecular formula C30H26N4O5S and a molecular weight of 554.63 g/mol. Its IUPAC name is (2E,5S)-N-(2,4-dimethylphenyl)-5-(4-methoxyphenyl)-7-methyl-2-[(3-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
| Compound Name | (2E,5S)-N-(2,4-dimethylphenyl)-5-(4-methoxyphenyl)-7-methyl-2-[(3-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 124533928 |
| Molecular Formula | C30H26N4O5S |
| Molecular Weight | 554.63 g/mol |
| Exact Mass | 554.16 |
| IUPAC Name | (2E,5S)-N-(2,4-dimethylphenyl)-5-(4-methoxyphenyl)-7-methyl-2-[(3-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccc([C@H]2C(C(=O)Nc3ccc(C)cc3C)=C(C)N=c3s/c(=C/c4cccc([N+](=O)[O-])c4)c(=O)n32)cc1 |
| InChI | InChI=1S/C30H26N4O5S/c1-17-8-13-24(18(2)14-17)32-28(35)26-19(3)31-30-33(27(26)21-9-11-23(39-4)12-10-21)29(36)25(40-30)16-20-6-5-7-22(15-20)34(37)38/h5-16,27H,1-4H3,(H,32,35)/b25-16+/t27-/m0/s1 |
| InChIKey | LVCXJXAZBAMDHG-QPJBPQEWSA-N |
| XLogP | 4.41 |
| TPSA | 115.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.63 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|