C36H34N4O3S — CID 124533917
(2Z,5R)-N-(2,4-dimethylphenyl)-2-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylidene]-5-(4-methoxyphenyl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 124533917) has the molecular formula C36H34N4O3S and a molecular weight of 602.76 g/mol. Its IUPAC name is (2Z,5R)-N-(2,4-dimethylphenyl)-2-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylidene]-5-(4-methoxyphenyl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
| Compound Name | (2Z,5R)-N-(2,4-dimethylphenyl)-2-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylidene]-5-(4-methoxyphenyl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 124533917 |
| Molecular Formula | C36H34N4O3S |
| Molecular Weight | 602.76 g/mol |
| Exact Mass | 602.24 |
| IUPAC Name | (2Z,5R)-N-(2,4-dimethylphenyl)-2-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylidene]-5-(4-methoxyphenyl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccc([C@@H]2C(C(=O)Nc3ccc(C)cc3C)=C(C)N=c3s/c(=C\c4cc(C)n(-c5ccccc5)c4C)c(=O)n32)cc1 |
| InChI | InChI=1S/C36H34N4O3S/c1-21-12-17-30(22(2)18-21)38-34(41)32-24(4)37-36-40(33(32)26-13-15-29(43-6)16-14-26)35(42)31(44-36)20-27-19-23(3)39(25(27)5)28-10-8-7-9-11-28/h7-20,33H,1-6H3,(H,38,41)/b31-20-/t33-/m1/s1 |
| InChIKey | PLEYRCKNYPSOGW-WXKAHTKJSA-N |
| XLogP | 5.91 |
| TPSA | 77.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.76 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|