C24H21N3O6S — CID 5350159
(2Z)-6-acetyl-5-(2,4-dimethoxyphenyl)-7-methyl-2-[(3-nitrophenyl)methylidene]-5H-[1,3]thiazolo[3,2-a]pyrimidin-3-one (PubChem CID 5350159) has the molecular formula C24H21N3O6S and a molecular weight of 479.51 g/mol. Its IUPAC name is (2Z)-6-acetyl-5-(2,4-dimethoxyphenyl)-7-methyl-2-[(3-nitrophenyl)methylidene]-5H-[1,3]thiazolo[3,2-a]pyrimidin-3-one.
| Compound Name | (2Z)-6-acetyl-5-(2,4-dimethoxyphenyl)-7-methyl-2-[(3-nitrophenyl)methylidene]-5H-[1,3]thiazolo[3,2-a]pyrimidin-3-one |
|---|---|
| PubChem CID | 5350159 |
| Molecular Formula | C24H21N3O6S |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | (2Z)-6-acetyl-5-(2,4-dimethoxyphenyl)-7-methyl-2-[(3-nitrophenyl)methylidene]-5H-[1,3]thiazolo[3,2-a]pyrimidin-3-one |
| SMILES | COc1ccc(C2C(C(C)=O)=C(C)N=c3s/c(=C\c4cccc([N+](=O)[O-])c4)c(=O)n32)c(OC)c1 |
| InChI | InChI=1S/C24H21N3O6S/c1-13-21(14(2)28)22(18-9-8-17(32-3)12-19(18)33-4)26-23(29)20(34-24(26)25-13)11-15-6-5-7-16(10-15)27(30)31/h5-12,22H,1-4H3/b20-11- |
| InChIKey | SGPSCOVFJAJSAH-JAIQZWGSSA-N |
| XLogP | 2.75 |
| TPSA | 113.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|