C31H26N4O10S — CID 124598813
ethyl (2Z,5R)-5-(2,4-dimethoxyphenyl)-2-[[4-(2,4-dinitrophenoxy)phenyl]methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 124598813) has the molecular formula C31H26N4O10S and a molecular weight of 646.63 g/mol. Its IUPAC name is ethyl (2Z,5R)-5-(2,4-dimethoxyphenyl)-2-[[4-(2,4-dinitrophenoxy)phenyl]methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2Z,5R)-5-(2,4-dimethoxyphenyl)-2-[[4-(2,4-dinitrophenoxy)phenyl]methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 124598813 |
| Molecular Formula | C31H26N4O10S |
| Molecular Weight | 646.63 g/mol |
| Exact Mass | 646.14 |
| IUPAC Name | ethyl (2Z,5R)-5-(2,4-dimethoxyphenyl)-2-[[4-(2,4-dinitrophenoxy)phenyl]methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=c2s/c(=C\c3ccc(Oc4ccc([N+](=O)[O-])cc4[N+](=O)[O-])cc3)c(=O)n2[C@@H]1c1ccc(OC)cc1OC |
| InChI | InChI=1S/C31H26N4O10S/c1-5-44-30(37)27-17(2)32-31-33(28(27)22-12-11-21(42-3)16-25(22)43-4)29(36)26(46-31)14-18-6-9-20(10-7-18)45-24-13-8-19(34(38)39)15-23(24)35(40)41/h6-16,28H,5H2,1-4H3/b26-14-/t28-/m1/s1 |
| InChIKey | RLPOFKITQZUKNB-DQARITGZSA-N |
| XLogP | 4.42 |
| TPSA | 174.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.63 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|