C30H24N4O9S — CID 5286986
ethyl (2E)-2-[[4-(2,4-dinitrophenoxy)phenyl]methylidene]-5-(4-methoxyphenyl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 5286986) has the molecular formula C30H24N4O9S and a molecular weight of 616.61 g/mol. Its IUPAC name is ethyl (2E)-2-[[4-(2,4-dinitrophenoxy)phenyl]methylidene]-5-(4-methoxyphenyl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2E)-2-[[4-(2,4-dinitrophenoxy)phenyl]methylidene]-5-(4-methoxyphenyl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 5286986 |
| Molecular Formula | C30H24N4O9S |
| Molecular Weight | 616.61 g/mol |
| Exact Mass | 616.13 |
| IUPAC Name | ethyl (2E)-2-[[4-(2,4-dinitrophenoxy)phenyl]methylidene]-5-(4-methoxyphenyl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=c2s/c(=C/c3ccc(Oc4ccc([N+](=O)[O-])cc4[N+](=O)[O-])cc3)c(=O)n2C1c1ccc(OC)cc1 |
| InChI | InChI=1S/C30H24N4O9S/c1-4-42-29(36)26-17(2)31-30-32(27(26)19-7-12-21(41-3)13-8-19)28(35)25(44-30)15-18-5-10-22(11-6-18)43-24-14-9-20(33(37)38)16-23(24)34(39)40/h5-16,27H,4H2,1-3H3/b25-15+ |
| InChIKey | ZHKHYCCEVOIRRU-MFKUBSTISA-N |
| XLogP | 4.42 |
| TPSA | 165.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.61 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|