C34H26N4O9S — CID 124599947
ethyl (2Z,5R)-2-[[4-(2,4-dinitrophenoxy)phenyl]methylidene]-5-(2-methoxynaphthalen-1-yl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 124599947) has the molecular formula C34H26N4O9S and a molecular weight of 666.67 g/mol. Its IUPAC name is ethyl (2Z,5R)-2-[[4-(2,4-dinitrophenoxy)phenyl]methylidene]-5-(2-methoxynaphthalen-1-yl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2Z,5R)-2-[[4-(2,4-dinitrophenoxy)phenyl]methylidene]-5-(2-methoxynaphthalen-1-yl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 124599947 |
| Molecular Formula | C34H26N4O9S |
| Molecular Weight | 666.67 g/mol |
| Exact Mass | 666.14 |
| IUPAC Name | ethyl (2Z,5R)-2-[[4-(2,4-dinitrophenoxy)phenyl]methylidene]-5-(2-methoxynaphthalen-1-yl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=c2s/c(=C\c3ccc(Oc4ccc([N+](=O)[O-])cc4[N+](=O)[O-])cc3)c(=O)n2[C@@H]1c1c(OC)ccc2ccccc12 |
| InChI | InChI=1S/C34H26N4O9S/c1-4-46-33(40)29-19(2)35-34-36(31(29)30-24-8-6-5-7-21(24)11-15-27(30)45-3)32(39)28(48-34)17-20-9-13-23(14-10-20)47-26-16-12-22(37(41)42)18-25(26)38(43)44/h5-18,31H,4H2,1-3H3/b28-17-/t31-/m0/s1 |
| InChIKey | LYPKHZIDSVTLNV-QYIOYSLNSA-N |
| XLogP | 5.57 |
| TPSA | 165.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.67 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|