C28H28N4O5S — CID 126054278
methyl (2Z,5R)-7-ethyl-2-[(5-nitro-2-piperidin-1-ylphenyl)methylidene]-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 126054278) has the molecular formula C28H28N4O5S and a molecular weight of 532.62 g/mol. Its IUPAC name is methyl (2Z,5R)-7-ethyl-2-[(5-nitro-2-piperidin-1-ylphenyl)methylidene]-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | methyl (2Z,5R)-7-ethyl-2-[(5-nitro-2-piperidin-1-ylphenyl)methylidene]-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 126054278 |
| Molecular Formula | C28H28N4O5S |
| Molecular Weight | 532.62 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | methyl (2Z,5R)-7-ethyl-2-[(5-nitro-2-piperidin-1-ylphenyl)methylidene]-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCC1=C(C(=O)OC)[C@@H](c2ccccc2)n2c(s/c(=C\c3cc([N+](=O)[O-])ccc3N3CCCCC3)c2=O)=N1 |
| InChI | InChI=1S/C28H28N4O5S/c1-3-21-24(27(34)37-2)25(18-10-6-4-7-11-18)31-26(33)23(38-28(31)29-21)17-19-16-20(32(35)36)12-13-22(19)30-14-8-5-9-15-30/h4,6-7,10-13,16-17,25H,3,5,8-9,14-15H2,1-2H3/b23-17-/t25-/m1/s1 |
| InChIKey | VAPWWWJDDQLTNW-IVNHJSRESA-N |
| XLogP | 3.70 |
| TPSA | 107.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.62 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|