C30H25N3O6S — CID 126042686
methyl (2E,5S)-7-ethyl-2-[[3-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 126042686) has the molecular formula C30H25N3O6S and a molecular weight of 555.61 g/mol. Its IUPAC name is methyl (2E,5S)-7-ethyl-2-[[3-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | methyl (2E,5S)-7-ethyl-2-[[3-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 126042686 |
| Molecular Formula | C30H25N3O6S |
| Molecular Weight | 555.61 g/mol |
| Exact Mass | 555.15 |
| IUPAC Name | methyl (2E,5S)-7-ethyl-2-[[3-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCC1=C(C(=O)OC)[C@H](c2ccccc2)n2c(s/c(=C/c3cccc(OCc4ccc([N+](=O)[O-])cc4)c3)c2=O)=N1 |
| InChI | InChI=1S/C30H25N3O6S/c1-3-24-26(29(35)38-2)27(21-9-5-4-6-10-21)32-28(34)25(40-30(32)31-24)17-20-8-7-11-23(16-20)39-18-19-12-14-22(15-13-19)33(36)37/h4-17,27H,3,18H2,1-2H3/b25-17+/t27-/m0/s1 |
| InChIKey | BFPDGVWLSKDYHC-CSJROMOCSA-N |
| XLogP | 4.29 |
| TPSA | 113.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.61 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|