C30H23Cl2N3O6S — CID 126045406
methyl (2Z,5S)-2-[[3,5-dichloro-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-7-ethyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 126045406) has the molecular formula C30H23Cl2N3O6S and a molecular weight of 624.50 g/mol. Its IUPAC name is methyl (2Z,5S)-2-[[3,5-dichloro-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-7-ethyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | methyl (2Z,5S)-2-[[3,5-dichloro-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-7-ethyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 126045406 |
| Molecular Formula | C30H23Cl2N3O6S |
| Molecular Weight | 624.50 g/mol |
| Exact Mass | 623.07 |
| IUPAC Name | methyl (2Z,5S)-2-[[3,5-dichloro-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-7-ethyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCC1=C(C(=O)OC)[C@H](c2ccccc2)n2c(s/c(=C\c3cc(Cl)c(OCc4cccc([N+](=O)[O-])c4)c(Cl)c3)c2=O)=N1 |
| InChI | InChI=1S/C30H23Cl2N3O6S/c1-3-23-25(29(37)40-2)26(19-9-5-4-6-10-19)34-28(36)24(42-30(34)33-23)15-18-13-21(31)27(22(32)14-18)41-16-17-8-7-11-20(12-17)35(38)39/h4-15,26H,3,16H2,1-2H3/b24-15-/t26-/m0/s1 |
| InChIKey | GBUPPRUBNUGRNH-RISWYLRJSA-N |
| XLogP | 5.59 |
| TPSA | 113.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.50 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|