C35H33N3O7S — CID 126053327
methyl (2Z,5S)-2-[[3-ethoxy-4-[(4-nitrophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-7-ethyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 126053327) has the molecular formula C35H33N3O7S and a molecular weight of 639.73 g/mol. Its IUPAC name is methyl (2Z,5S)-2-[[3-ethoxy-4-[(4-nitrophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-7-ethyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | methyl (2Z,5S)-2-[[3-ethoxy-4-[(4-nitrophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-7-ethyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 126053327 |
| Molecular Formula | C35H33N3O7S |
| Molecular Weight | 639.73 g/mol |
| Exact Mass | 639.20 |
| IUPAC Name | methyl (2Z,5S)-2-[[3-ethoxy-4-[(4-nitrophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-7-ethyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | C=CCc1cc(/C=c2\sc3n(c2=O)[C@@H](c2ccccc2)C(C(=O)OC)=C(CC)N=3)cc(OCC)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C35H33N3O7S/c1-5-11-25-18-23(19-28(44-7-3)32(25)45-21-22-14-16-26(17-15-22)38(41)42)20-29-33(39)37-31(24-12-9-8-10-13-24)30(34(40)43-4)27(6-2)36-35(37)46-29/h5,8-10,12-20,31H,1,6-7,11,21H2,2-4H3/b29-20-/t31-/m0/s1 |
| InChIKey | LJLUVLOOEIZALI-DEDRDRDXSA-N |
| XLogP | 5.41 |
| TPSA | 122.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.73 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|