C25H23N3O8S — CID 3456141
ethyl 5-(3,4-dimethoxyphenyl)-2-[(4-hydroxy-3-nitrophenyl)methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 3456141) has the molecular formula C25H23N3O8S and a molecular weight of 525.54 g/mol. Its IUPAC name is ethyl 5-(3,4-dimethoxyphenyl)-2-[(4-hydroxy-3-nitrophenyl)methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl 5-(3,4-dimethoxyphenyl)-2-[(4-hydroxy-3-nitrophenyl)methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 3456141 |
| Molecular Formula | C25H23N3O8S |
| Molecular Weight | 525.54 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | ethyl 5-(3,4-dimethoxyphenyl)-2-[(4-hydroxy-3-nitrophenyl)methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=c2sc(=Cc3ccc(O)c([N+](=O)[O-])c3)c(=O)n2C1c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C25H23N3O8S/c1-5-36-24(31)21-13(2)26-25-27(22(21)15-7-9-18(34-3)19(12-15)35-4)23(30)20(37-25)11-14-6-8-17(29)16(10-14)28(32)33/h6-12,22,29H,5H2,1-4H3 |
| InChIKey | IFTQXIHBKHSSAX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 142.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.54 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|