C26H25N3O7S — CID 126189033
ethyl (2E,5S)-2-[(3,4-dimethoxyphenyl)methylidene]-7-methyl-5-(4-methyl-3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 126189033) has the molecular formula C26H25N3O7S and a molecular weight of 523.57 g/mol. Its IUPAC name is ethyl (2E,5S)-2-[(3,4-dimethoxyphenyl)methylidene]-7-methyl-5-(4-methyl-3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2E,5S)-2-[(3,4-dimethoxyphenyl)methylidene]-7-methyl-5-(4-methyl-3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 126189033 |
| Molecular Formula | C26H25N3O7S |
| Molecular Weight | 523.57 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | ethyl (2E,5S)-2-[(3,4-dimethoxyphenyl)methylidene]-7-methyl-5-(4-methyl-3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=c2s/c(=C/c3ccc(OC)c(OC)c3)c(=O)n2[C@H]1c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H25N3O7S/c1-6-36-25(31)22-15(3)27-26-28(23(22)17-9-7-14(2)18(13-17)29(32)33)24(30)21(37-26)12-16-8-10-19(34-4)20(11-16)35-5/h7-13,23H,6H2,1-5H3/b21-12+/t23-/m0/s1 |
| InChIKey | NRZDJEJJMFZLSL-NWKGEQBZSA-N |
| XLogP | 3.03 |
| TPSA | 122.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.57 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|