C36H27N3O8S — CID 4250781
ethyl 5-(1,3-benzodioxol-5-yl)-2-[[2-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 4250781) has the molecular formula C36H27N3O8S and a molecular weight of 661.69 g/mol. Its IUPAC name is ethyl 5-(1,3-benzodioxol-5-yl)-2-[[2-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl 5-(1,3-benzodioxol-5-yl)-2-[[2-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 4250781 |
| Molecular Formula | C36H27N3O8S |
| Molecular Weight | 661.69 g/mol |
| Exact Mass | 661.15 |
| IUPAC Name | ethyl 5-(1,3-benzodioxol-5-yl)-2-[[2-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)N=c2sc(=Cc3ccccc3OCc3ccc([N+](=O)[O-])cc3)c(=O)n2C1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C36H27N3O8S/c1-2-44-35(41)31-32(23-8-4-3-5-9-23)37-36-38(33(31)25-14-17-28-29(18-25)47-21-46-28)34(40)30(48-36)19-24-10-6-7-11-27(24)45-20-22-12-15-26(16-13-22)39(42)43/h3-19,33H,2,20-21H2,1H3 |
| InChIKey | FQORPOTYDJXCGX-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 131.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.69 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|