C29H32N4O6S — CID 126002612
ethyl (2E,5S)-2-[[2-(diethylamino)-5-nitrophenyl]methylidene]-5-(4-ethoxyphenyl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 126002612) has the molecular formula C29H32N4O6S and a molecular weight of 564.66 g/mol. Its IUPAC name is ethyl (2E,5S)-2-[[2-(diethylamino)-5-nitrophenyl]methylidene]-5-(4-ethoxyphenyl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2E,5S)-2-[[2-(diethylamino)-5-nitrophenyl]methylidene]-5-(4-ethoxyphenyl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 126002612 |
| Molecular Formula | C29H32N4O6S |
| Molecular Weight | 564.66 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | ethyl (2E,5S)-2-[[2-(diethylamino)-5-nitrophenyl]methylidene]-5-(4-ethoxyphenyl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=c2s/c(=C/c3cc([N+](=O)[O-])ccc3N(CC)CC)c(=O)n2[C@H]1c1ccc(OCC)cc1 |
| InChI | InChI=1S/C29H32N4O6S/c1-6-31(7-2)23-15-12-21(33(36)37)16-20(23)17-24-27(34)32-26(19-10-13-22(14-11-19)38-8-3)25(28(35)39-9-4)18(5)30-29(32)40-24/h10-17,26H,6-9H2,1-5H3/b24-17+/t26-/m0/s1 |
| InChIKey | GHTXRXVJLLUCSG-ASSGYOTOSA-N |
| XLogP | 3.95 |
| TPSA | 116.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.66 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|