C30H32N4O9S — CID 126047051
ethyl (2Z,5S)-2-[[2-(dimethylamino)-5-nitrophenyl]methylidene]-5-[3-ethoxy-4-(2-methoxy-2-oxoethoxy)phenyl]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 126047051) has the molecular formula C30H32N4O9S and a molecular weight of 624.67 g/mol. Its IUPAC name is ethyl (2Z,5S)-2-[[2-(dimethylamino)-5-nitrophenyl]methylidene]-5-[3-ethoxy-4-(2-methoxy-2-oxoethoxy)phenyl]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2Z,5S)-2-[[2-(dimethylamino)-5-nitrophenyl]methylidene]-5-[3-ethoxy-4-(2-methoxy-2-oxoethoxy)phenyl]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 126047051 |
| Molecular Formula | C30H32N4O9S |
| Molecular Weight | 624.67 g/mol |
| Exact Mass | 624.19 |
| IUPAC Name | ethyl (2Z,5S)-2-[[2-(dimethylamino)-5-nitrophenyl]methylidene]-5-[3-ethoxy-4-(2-methoxy-2-oxoethoxy)phenyl]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=c2s/c(=C\c3cc([N+](=O)[O-])ccc3N(C)C)c(=O)n2[C@H]1c1ccc(OCC(=O)OC)c(OCC)c1 |
| InChI | InChI=1S/C30H32N4O9S/c1-7-41-23-14-18(9-12-22(23)43-16-25(35)40-6)27-26(29(37)42-8-2)17(3)31-30-33(27)28(36)24(44-30)15-19-13-20(34(38)39)10-11-21(19)32(4)5/h9-15,27H,7-8,16H2,1-6H3/b24-15-/t27-/m0/s1 |
| InChIKey | SZRMZULOBNQMKH-LKWZWFHSSA-N |
| XLogP | 2.72 |
| TPSA | 151.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.67 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|