C29H22N4O9S — CID 5115865
methyl 2-[[2-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-7-methyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 5115865) has the molecular formula C29H22N4O9S and a molecular weight of 602.58 g/mol. Its IUPAC name is methyl 2-[[2-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-7-methyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | methyl 2-[[2-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-7-methyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 5115865 |
| Molecular Formula | C29H22N4O9S |
| Molecular Weight | 602.58 g/mol |
| Exact Mass | 602.11 |
| IUPAC Name | methyl 2-[[2-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-7-methyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | COC(=O)C1=C(C)N=c2sc(=Cc3cccc(OC)c3Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c(=O)n2C1c1ccccc1 |
| InChI | InChI=1S/C29H22N4O9S/c1-16-24(28(35)41-3)25(17-8-5-4-6-9-17)31-27(34)23(43-29(31)30-16)14-18-10-7-11-22(40-2)26(18)42-21-13-12-19(32(36)37)15-20(21)33(38)39/h4-15,25H,1-3H3 |
| InChIKey | ICCUNZLXSBJRTE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 165.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.58 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|