C30H25N3O7S — CID 3923752
methyl 2-[(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylidene]-7-methyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 3923752) has the molecular formula C30H25N3O7S and a molecular weight of 571.61 g/mol. Its IUPAC name is methyl 2-[(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylidene]-7-methyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | methyl 2-[(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylidene]-7-methyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 3923752 |
| Molecular Formula | C30H25N3O7S |
| Molecular Weight | 571.61 g/mol |
| Exact Mass | 571.14 |
| IUPAC Name | methyl 2-[(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylidene]-7-methyl-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | COC(=O)C1=C(C)N=c2sc(=Cc3cc(OC)c(OCc4ccccc4)cc3[N+](=O)[O-])c(=O)n2C1c1ccccc1 |
| InChI | InChI=1S/C30H25N3O7S/c1-18-26(29(35)39-3)27(20-12-8-5-9-13-20)32-28(34)25(41-30(32)31-18)15-21-14-23(38-2)24(16-22(21)33(36)37)40-17-19-10-6-4-7-11-19/h4-16,27H,17H2,1-3H3 |
| InChIKey | QMARARSHRTXNBO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 122.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.61 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|