C18H13N3O5S — CID 124630948
(2Z)-2-[(2,4-dimethoxy-5-nitrophenyl)methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one (PubChem CID 124630948) has the molecular formula C18H13N3O5S and a molecular weight of 383.39 g/mol. Its IUPAC name is (2Z)-2-[(2,4-dimethoxy-5-nitrophenyl)methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one.
| Compound Name | (2Z)-2-[(2,4-dimethoxy-5-nitrophenyl)methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
|---|---|
| PubChem CID | 124630948 |
| Molecular Formula | C18H13N3O5S |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | (2Z)-2-[(2,4-dimethoxy-5-nitrophenyl)methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
| SMILES | COc1cc(OC)c([N+](=O)[O-])cc1/C=c1\sc2nc3ccccc3n2c1=O |
| InChI | InChI=1S/C18H13N3O5S/c1-25-14-9-15(26-2)13(21(23)24)7-10(14)8-16-17(22)20-12-6-4-3-5-11(12)19-18(20)27-16/h3-9H,1-2H3/b16-8- |
| InChIKey | OTZVTUCSXFOTLN-PXNMLYILSA-N |
| XLogP | 2.38 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|