C18H14N2O5S2 — CID 2928933
[4-methoxy-2-[(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]phenyl] methanesulfonate (PubChem CID 2928933) has the molecular formula C18H14N2O5S2 and a molecular weight of 402.45 g/mol. Its IUPAC name is [4-methoxy-2-[(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]phenyl] methanesulfonate.
| Compound Name | [4-methoxy-2-[(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 2928933 |
| Molecular Formula | C18H14N2O5S2 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | [4-methoxy-2-[(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-ylidene)methyl]phenyl] methanesulfonate |
| SMILES | COc1ccc(OS(C)(=O)=O)c(C=c2sc3nc4ccccc4n3c2=O)c1 |
| InChI | InChI=1S/C18H14N2O5S2/c1-24-12-7-8-15(25-27(2,22)23)11(9-12)10-16-17(21)20-14-6-4-3-5-13(14)19-18(20)26-16/h3-10H,1-2H3 |
| InChIKey | HZVYMXAMHYKIOZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|