C17H13FN2O5S2 — CID 50871583
[2-methoxy-4-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 50871583) has the molecular formula C17H13FN2O5S2 and a molecular weight of 408.43 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [2-methoxy-4-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 50871583 |
| Molecular Formula | C17H13FN2O5S2 |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | [2-methoxy-4-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | COc1cc(/C=C2/NC(=S)NC2=O)ccc1OS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H13FN2O5S2/c1-24-15-9-10(8-13-16(21)20-17(26)19-13)2-7-14(15)25-27(22,23)12-5-3-11(18)4-6-12/h2-9H,1H3,(H2,19,20,21,26)/b13-8+ |
| InChIKey | ISKSKBTXOUBLGJ-MDWZMJQESA-N |
| XLogP | 1.95 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|