C18H13N3O6S — CID 124544780
[2-methoxy-4-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenyl] 4-nitrobenzoate (PubChem CID 124544780) has the molecular formula C18H13N3O6S and a molecular weight of 399.38 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenyl] 4-nitrobenzoate.
| Compound Name | [2-methoxy-4-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 124544780 |
| Molecular Formula | C18H13N3O6S |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | [2-methoxy-4-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenyl] 4-nitrobenzoate |
| SMILES | COc1cc(/C=C2/NC(=S)NC2=O)ccc1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H13N3O6S/c1-26-15-9-10(8-13-16(22)20-18(28)19-13)2-7-14(15)27-17(23)11-3-5-12(6-4-11)21(24)25/h2-9H,1H3,(H2,19,20,22,28)/b13-8+ |
| InChIKey | PFXWUPNSBQAVIS-MDWZMJQESA-N |
| XLogP | 2.17 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|