C19H14N2O5S — CID 5191709
[4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-methoxyphenyl] benzoate (PubChem CID 5191709) has the molecular formula C19H14N2O5S and a molecular weight of 382.40 g/mol. Its IUPAC name is [4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-methoxyphenyl] benzoate.
| Compound Name | [4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-methoxyphenyl] benzoate |
|---|---|
| PubChem CID | 5191709 |
| Molecular Formula | C19H14N2O5S |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | [4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-methoxyphenyl] benzoate |
| SMILES | COc1cc(C=C2C(=O)NC(=S)NC2=O)ccc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H14N2O5S/c1-25-15-10-11(9-13-16(22)20-19(27)21-17(13)23)7-8-14(15)26-18(24)12-5-3-2-4-6-12/h2-10H,1H3,(H2,20,21,22,23,27) |
| InChIKey | BNTHRZBHKUHXQQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|