C19H13ClN2O5S — CID 4616498
[4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-methoxyphenyl] 2-chlorobenzoate (PubChem CID 4616498) has the molecular formula C19H13ClN2O5S and a molecular weight of 416.84 g/mol. Its IUPAC name is [4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-methoxyphenyl] 2-chlorobenzoate.
| Compound Name | [4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-methoxyphenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 4616498 |
| Molecular Formula | C19H13ClN2O5S |
| Molecular Weight | 416.84 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | [4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-methoxyphenyl] 2-chlorobenzoate |
| SMILES | COc1cc(C=C2C(=O)NC(=S)NC2=O)ccc1OC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C19H13ClN2O5S/c1-26-15-9-10(8-12-16(23)21-19(28)22-17(12)24)6-7-14(15)27-18(25)11-4-2-3-5-13(11)20/h2-9H,1H3,(H2,21,22,23,24,28) |
| InChIKey | HVZQBJYWUOJGQQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.84 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|