C19H13BrN2O6 — CID 19589061
[2-methoxy-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenyl] 2-bromobenzoate (PubChem CID 19589061) has the molecular formula C19H13BrN2O6 and a molecular weight of 445.23 g/mol. Its IUPAC name is [2-methoxy-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenyl] 2-bromobenzoate.
| Compound Name | [2-methoxy-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenyl] 2-bromobenzoate |
|---|---|
| PubChem CID | 19589061 |
| Molecular Formula | C19H13BrN2O6 |
| Molecular Weight | 445.23 g/mol |
| Exact Mass | 444.00 |
| IUPAC Name | [2-methoxy-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenyl] 2-bromobenzoate |
| SMILES | COc1cc(C=C2C(=O)NC(=O)NC2=O)ccc1OC(=O)c1ccccc1Br |
| InChI | InChI=1S/C19H13BrN2O6/c1-27-15-9-10(8-12-16(23)21-19(26)22-17(12)24)6-7-14(15)28-18(25)11-4-2-3-5-13(11)20/h2-9H,1H3,(H2,21,22,23,24,26) |
| InChIKey | HKPJDHMCGNTRML-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.23 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|