C24H17N3O6S — CID 135459174
[2-methoxy-4-[(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-nitrobenzoate (PubChem CID 135459174) has the molecular formula C24H17N3O6S and a molecular weight of 475.48 g/mol. Its IUPAC name is [2-methoxy-4-[(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-nitrobenzoate.
| Compound Name | [2-methoxy-4-[(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 135459174 |
| Molecular Formula | C24H17N3O6S |
| Molecular Weight | 475.48 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | [2-methoxy-4-[(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-nitrobenzoate |
| SMILES | COc1cc(C=C2S/C(=N/c3ccccc3)NC2=O)ccc1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H17N3O6S/c1-32-20-13-15(14-21-22(28)26-24(34-21)25-17-5-3-2-4-6-17)7-12-19(20)33-23(29)16-8-10-18(11-9-16)27(30)31/h2-14H,1H3,(H,25,26,28) |
| InChIKey | ZMFVEAVWXUMJQJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 120.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.48 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|