C23H14N4O7S — CID 135456909
[3-[(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenyl] 3,5-dinitrobenzoate (PubChem CID 135456909) has the molecular formula C23H14N4O7S and a molecular weight of 490.45 g/mol. Its IUPAC name is [3-[(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenyl] 3,5-dinitrobenzoate.
| Compound Name | [3-[(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenyl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 135456909 |
| Molecular Formula | C23H14N4O7S |
| Molecular Weight | 490.45 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | [3-[(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenyl] 3,5-dinitrobenzoate |
| SMILES | O=C1N/C(=N/c2ccccc2)SC1=Cc1cccc(OC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C23H14N4O7S/c28-21-20(35-23(25-21)24-16-6-2-1-3-7-16)10-14-5-4-8-19(9-14)34-22(29)15-11-17(26(30)31)13-18(12-15)27(32)33/h1-13H,(H,24,25,28) |
| InChIKey | QTZPQATZSMPRLK-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 154.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.45 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|