C24H17FN2O3S — CID 137069601
[3-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 3-fluorobenzoate (PubChem CID 137069601) has the molecular formula C24H17FN2O3S and a molecular weight of 432.48 g/mol. Its IUPAC name is [3-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 3-fluorobenzoate.
| Compound Name | [3-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 3-fluorobenzoate |
|---|---|
| PubChem CID | 137069601 |
| Molecular Formula | C24H17FN2O3S |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | [3-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 3-fluorobenzoate |
| SMILES | Cc1ccc(/N=C2\NC(=O)/C(=C/c3cccc(OC(=O)c4cccc(F)c4)c3)S2)cc1 |
| InChI | InChI=1S/C24H17FN2O3S/c1-15-8-10-19(11-9-15)26-24-27-22(28)21(31-24)13-16-4-2-7-20(12-16)30-23(29)17-5-3-6-18(25)14-17/h2-14H,1H3,(H,26,27,28)/b21-13- |
| InChIKey | SCOLEOFSGVXPDI-BKUYFWCQSA-N |
| XLogP | 5.24 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|