C13H13NNaO5S3+ — CID 54611140
sodium 5-[(Z)-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-methoxybenzenesulfonic acid (PubChem CID 54611140) has the molecular formula C13H13NNaO5S3+ and a molecular weight of 382.44 g/mol. Its IUPAC name is sodium 5-[(Z)-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-methoxybenzenesulfonic acid.
| Compound Name | sodium 5-[(Z)-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-methoxybenzenesulfonic acid |
|---|---|
| PubChem CID | 54611140 |
| Molecular Formula | C13H13NNaO5S3+ |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 381.98 |
| IUPAC Name | sodium 5-[(Z)-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-methoxybenzenesulfonic acid |
| SMILES | CCN1C(=O)/C(=C/c2ccc(OC)c(S(=O)(=O)O)c2)SC1=S.[Na+] |
| InChI | InChI=1S/C13H13NO5S3.Na/c1-3-14-12(15)10(21-13(14)20)6-8-4-5-9(19-2)11(7-8)22(16,17)18;/h4-7H,3H2,1-2H3,(H,16,17,18);/q;+1/b10-6-; |
| InChIKey | DWHZLEJKEWXTOI-OTUCAILMSA-N |
| XLogP | -0.83 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|