C15H15NO7S3 — CID 72654627
4-[5-[(4-methoxy-3-sulfophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid (PubChem CID 72654627) has the molecular formula C15H15NO7S3 and a molecular weight of 417.49 g/mol. Its IUPAC name is 4-[5-[(4-methoxy-3-sulfophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid.
| Compound Name | 4-[5-[(4-methoxy-3-sulfophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 72654627 |
| Molecular Formula | C15H15NO7S3 |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.00 |
| IUPAC Name | 4-[5-[(4-methoxy-3-sulfophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
| SMILES | COc1ccc(C=C2SC(=S)N(CCCC(=O)O)C2=O)cc1S(=O)(=O)O |
| InChI | InChI=1S/C15H15NO7S3/c1-23-10-5-4-9(8-12(10)26(20,21)22)7-11-14(19)16(15(24)25-11)6-2-3-13(17)18/h4-5,7-8H,2-3,6H2,1H3,(H,17,18)(H,20,21,22) |
| InChIKey | KISIPQBNBNTNBE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|