C22H19Cl2NO5S2 — CID 19199016
4-[(5Z)-5-[[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid (PubChem CID 19199016) has the molecular formula C22H19Cl2NO5S2 and a molecular weight of 512.44 g/mol. Its IUPAC name is 4-[(5Z)-5-[[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid.
| Compound Name | 4-[(5Z)-5-[[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 19199016 |
| Molecular Formula | C22H19Cl2NO5S2 |
| Molecular Weight | 512.44 g/mol |
| Exact Mass | 511.01 |
| IUPAC Name | 4-[(5Z)-5-[[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
| SMILES | COc1cc(/C=C2\SC(=S)N(CCCC(=O)O)C2=O)ccc1OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C22H19Cl2NO5S2/c1-29-18-10-13(7-8-17(18)30-12-14-15(23)4-2-5-16(14)24)11-19-21(28)25(22(31)32-19)9-3-6-20(26)27/h2,4-5,7-8,10-11H,3,6,9,12H2,1H3,(H,26,27)/b19-11- |
| InChIKey | YLLBSIGDEBMCNP-ODLFYWEKSA-N |
| XLogP | 5.65 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.44 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|