C26H19Cl2NO5S2 — CID 19197597
2-[(5Z)-5-[[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetic acid (PubChem CID 19197597) has the molecular formula C26H19Cl2NO5S2 and a molecular weight of 560.48 g/mol. Its IUPAC name is 2-[(5Z)-5-[[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetic acid.
| Compound Name | 2-[(5Z)-5-[[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetic acid |
|---|---|
| PubChem CID | 19197597 |
| Molecular Formula | C26H19Cl2NO5S2 |
| Molecular Weight | 560.48 g/mol |
| Exact Mass | 559.01 |
| IUPAC Name | 2-[(5Z)-5-[[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetic acid |
| SMILES | COc1cc(/C=C2\SC(=S)N(C(C(=O)O)c3ccccc3)C2=O)ccc1OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C26H19Cl2NO5S2/c1-33-21-12-15(10-11-20(21)34-14-17-18(27)8-5-9-19(17)28)13-22-24(30)29(26(35)36-22)23(25(31)32)16-6-3-2-4-7-16/h2-13,23H,14H2,1H3,(H,31,32)/b22-13- |
| InChIKey | QAHJLALMADRXSM-XKZIYDEJSA-N |
| XLogP | 6.61 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.48 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|