C26H27Cl2NO5S2 — CID 19199588
propyl 4-[(5Z)-5-[[4-[(2,6-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate (PubChem CID 19199588) has the molecular formula C26H27Cl2NO5S2 and a molecular weight of 568.54 g/mol. Its IUPAC name is propyl 4-[(5Z)-5-[[4-[(2,6-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate.
| Compound Name | propyl 4-[(5Z)-5-[[4-[(2,6-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate |
|---|---|
| PubChem CID | 19199588 |
| Molecular Formula | C26H27Cl2NO5S2 |
| Molecular Weight | 568.54 g/mol |
| Exact Mass | 567.07 |
| IUPAC Name | propyl 4-[(5Z)-5-[[4-[(2,6-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate |
| SMILES | CCCOC(=O)CCCN1C(=O)/C(=C/c2ccc(OCc3c(Cl)cccc3Cl)c(OCC)c2)SC1=S |
| InChI | InChI=1S/C26H27Cl2NO5S2/c1-3-13-33-24(30)9-6-12-29-25(31)23(36-26(29)35)15-17-10-11-21(22(14-17)32-4-2)34-16-18-19(27)7-5-8-20(18)28/h5,7-8,10-11,14-15H,3-4,6,9,12-13,16H2,1-2H3/b23-15- |
| InChIKey | VIRZVQMJLVYMLE-HAHDFKILSA-N |
| XLogP | 6.91 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.54 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|