C25H25ClFNO5S2 — CID 19195878
methyl 6-[(5E)-5-[[4-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate (PubChem CID 19195878) has the molecular formula C25H25ClFNO5S2 and a molecular weight of 538.06 g/mol. Its IUPAC name is methyl 6-[(5E)-5-[[4-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate.
| Compound Name | methyl 6-[(5E)-5-[[4-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate |
|---|---|
| PubChem CID | 19195878 |
| Molecular Formula | C25H25ClFNO5S2 |
| Molecular Weight | 538.06 g/mol |
| Exact Mass | 537.08 |
| IUPAC Name | methyl 6-[(5E)-5-[[4-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate |
| SMILES | COC(=O)CCCCCN1C(=O)/C(=C\c2ccc(OCc3c(F)cccc3Cl)c(OC)c2)SC1=S |
| InChI | InChI=1S/C25H25ClFNO5S2/c1-31-21-13-16(10-11-20(21)33-15-17-18(26)7-6-8-19(17)27)14-22-24(30)28(25(34)35-22)12-5-3-4-9-23(29)32-2/h6-8,10-11,13-14H,3-5,9,12,15H2,1-2H3/b22-14+ |
| InChIKey | USHLUDZKBHWNBV-HYARGMPZSA-N |
| XLogP | 6.00 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.06 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|