C25H21NO3S2 — CID 73385379
3-benzyl-5-[(4-methoxy-3-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 73385379) has the molecular formula C25H21NO3S2 and a molecular weight of 447.58 g/mol. Its IUPAC name is 3-benzyl-5-[(4-methoxy-3-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-benzyl-5-[(4-methoxy-3-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 73385379 |
| Molecular Formula | C25H21NO3S2 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | 3-benzyl-5-[(4-methoxy-3-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(C=C2SC(=S)N(Cc3ccccc3)C2=O)cc1OCc1ccccc1 |
| InChI | InChI=1S/C25H21NO3S2/c1-28-21-13-12-20(14-22(21)29-17-19-10-6-3-7-11-19)15-23-24(27)26(25(30)31-23)16-18-8-4-2-5-9-18/h2-15H,16-17H2,1H3 |
| InChIKey | CGGUKKXDATYIPW-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|