C31H23BrCl2N2O5S2 — CID 126089497
[2-bromo-4-[(E)-[3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenyl] benzenesulfonate (PubChem CID 126089497) has the molecular formula C31H23BrCl2N2O5S2 and a molecular weight of 718.48 g/mol. Its IUPAC name is [2-bromo-4-[(E)-[3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenyl] benzenesulfonate.
| Compound Name | [2-bromo-4-[(E)-[3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126089497 |
| Molecular Formula | C31H23BrCl2N2O5S2 |
| Molecular Weight | 718.48 g/mol |
| Exact Mass | 715.96 |
| IUPAC Name | [2-bromo-4-[(E)-[3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenyl] benzenesulfonate |
| SMILES | COc1cc(/C=C2/S/C(=N\c3ccc(C)c(Cl)c3)N(c3ccc(C)c(Cl)c3)C2=O)cc(Br)c1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C31H23BrCl2N2O5S2/c1-18-9-11-21(16-25(18)33)35-31-36(22-12-10-19(2)26(34)17-22)30(37)28(42-31)15-20-13-24(32)29(27(14-20)40-3)41-43(38,39)23-7-5-4-6-8-23/h4-17H,1-3H3/b28-15+,35-31- |
| InChIKey | RZWQHPQVSRAWKM-RUSCDZRNSA-N |
| XLogP | 8.96 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.48 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|