C29H27BrN2O4S — CID 18531322
[2-bromo-4-[(Z)-[3-(3,4-dimethylphenyl)-2-(3,4-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenyl] acetate (PubChem CID 18531322) has the molecular formula C29H27BrN2O4S and a molecular weight of 579.52 g/mol. Its IUPAC name is [2-bromo-4-[(Z)-[3-(3,4-dimethylphenyl)-2-(3,4-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenyl] acetate.
| Compound Name | [2-bromo-4-[(Z)-[3-(3,4-dimethylphenyl)-2-(3,4-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 18531322 |
| Molecular Formula | C29H27BrN2O4S |
| Molecular Weight | 579.52 g/mol |
| Exact Mass | 578.09 |
| IUPAC Name | [2-bromo-4-[(Z)-[3-(3,4-dimethylphenyl)-2-(3,4-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenyl] acetate |
| SMILES | COc1cc(/C=C2\S/C(=N\c3ccc(C)c(C)c3)N(c3ccc(C)c(C)c3)C2=O)cc(Br)c1OC(C)=O |
| InChI | InChI=1S/C29H27BrN2O4S/c1-16-7-9-22(11-18(16)3)31-29-32(23-10-8-17(2)19(4)12-23)28(34)26(37-29)15-21-13-24(30)27(36-20(5)33)25(14-21)35-6/h7-15H,1-6H3/b26-15-,31-29- |
| InChIKey | UNVMVILCTJWIRD-ZLEOPLMGSA-N |
| XLogP | 7.43 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.52 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|