C29H30N2O4S — CID 4247637
3-(4-ethylphenyl)-2-(4-ethylphenyl)imino-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 4247637) has the molecular formula C29H30N2O4S and a molecular weight of 502.64 g/mol. Its IUPAC name is 3-(4-ethylphenyl)-2-(4-ethylphenyl)imino-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 3-(4-ethylphenyl)-2-(4-ethylphenyl)imino-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4247637 |
| Molecular Formula | C29H30N2O4S |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | 3-(4-ethylphenyl)-2-(4-ethylphenyl)imino-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCc1ccc(/N=C2\SC(=Cc3cc(OC)c(OC)c(OC)c3)C(=O)N2c2ccc(CC)cc2)cc1 |
| InChI | InChI=1S/C29H30N2O4S/c1-6-19-8-12-22(13-9-19)30-29-31(23-14-10-20(7-2)11-15-23)28(32)26(36-29)18-21-16-24(33-3)27(35-5)25(17-21)34-4/h8-18H,6-7H2,1-5H3/b26-18?,30-29- |
| InChIKey | JVCLZBLMSHYVJI-GLJLAGNYSA-N |
| XLogP | 6.65 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|