C32H28N2O5S — CID 4016327
3-(4-methoxyphenyl)-2-(4-methoxyphenyl)imino-5-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 4016327) has the molecular formula C32H28N2O5S and a molecular weight of 552.65 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-2-(4-methoxyphenyl)imino-5-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 3-(4-methoxyphenyl)-2-(4-methoxyphenyl)imino-5-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4016327 |
| Molecular Formula | C32H28N2O5S |
| Molecular Weight | 552.65 g/mol |
| Exact Mass | 552.17 |
| IUPAC Name | 3-(4-methoxyphenyl)-2-(4-methoxyphenyl)imino-5-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(/N=C2\SC(=Cc3ccc(OCc4ccccc4)c(OC)c3)C(=O)N2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H28N2O5S/c1-36-26-14-10-24(11-15-26)33-32-34(25-12-16-27(37-2)17-13-25)31(35)30(40-32)20-23-9-18-28(29(19-23)38-3)39-21-22-7-5-4-6-8-22/h4-20H,21H2,1-3H3/b30-20?,33-32- |
| InChIKey | MOTISIMTDSNORW-VGCOJFONSA-N |
| XLogP | 7.10 |
| TPSA | 69.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.65 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|